Type: Neutral
Formula: C13H23N3O5S
SMILES: |
S(C(N1C=CC(=NC1=O)N)C(O)C(O)C(O)CO)CC(C)C |
InChI: |
InChI=1/C13H23N3O5S/c1-7(2)6-22-12(11(20)10(19)8(18)5-17)16-4-3-9(14)15-13(16)21/h3-4,7-8,10-12,17-20H,5-6H2,1-2H3,(H2,14,15,21)/t8-,10-,11+,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 333.409 g/mol | logS: -1.30102 | SlogP: -0.9168 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.126508 | Sterimol/B1: 2.54636 | Sterimol/B2: 3.18601 | Sterimol/B3: 4.41278 |
Sterimol/B4: 8.461 | Sterimol/L: 15.0889 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 547.279 | Positive charged surface: 349.567 | Negative charged surface: 197.712 | Volume: 299.5 |
Hydrophobic surface: 208.378 | Hydrophilic surface: 338.901 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |