Type: Neutral
Formula: C17H18N2O7
SMILES: |
O1C(COC(Oc2ccccc2)=O)C(O)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C17H18N2O7/c1-10-8-19(16(22)18-15(10)21)14-7-12(20)13(26-14)9-24-17(23)25-11-5-3-2-4-6-11/h2-6,8,12-14,20H,7,9H2,1H3,(H,18,21,22)/t12-,13+,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.338 g/mol | logS: -2.71277 | SlogP: 1.1335 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0252448 | Sterimol/B1: 2.03824 | Sterimol/B2: 2.78576 | Sterimol/B3: 3.50452 |
Sterimol/B4: 9.68861 | Sterimol/L: 17.8082 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 620.152 | Positive charged surface: 374.686 | Negative charged surface: 245.466 | Volume: 317.375 |
Hydrophobic surface: 405.139 | Hydrophilic surface: 215.013 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |