Type: Neutral
Formula: C16H25NO9
| SMILES: |
O1C(CO)C(O)C(O)C(O)C1OC/1CC(OC)C(OC)C(O)\C\1=C/C#N |
| InChI: |
InChI=1/C16H25NO9/c1-23-9-5-8(7(3-4-17)11(19)15(9)24-2)25-16-14(22)13(21)12(20)10(6-18)26-16/h3,8-16,18-22H,5-6H2,1-2H3/b7-3+/t8-,9+,10-,11-,12+,13+,14+,15+,16-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 375.374 g/mol | logS: -0.42136 | SlogP: -2.58392 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.188787 | Sterimol/B1: 2.38812 | Sterimol/B2: 3.29555 | Sterimol/B3: 5.5944 |
| Sterimol/B4: 9.18653 | Sterimol/L: 12.4451 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 561.642 | Positive charged surface: 465.917 | Negative charged surface: 95.7249 | Volume: 329.375 |
| Hydrophobic surface: 324.346 | Hydrophilic surface: 237.296 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 9 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |