Type: Neutral
Formula: C18H18Cl2N2O6S
SMILES: |
Clc1cc(SCC(OCC2OC(N3C=C(C)C(=O)NC3=O)CC2O)=O)ccc1Cl |
InChI: |
InChI=1/C18H18Cl2N2O6S/c1-9-6-22(18(26)21-17(9)25)15-5-13(23)14(28-15)7-27-16(24)8-29-10-2-3-11(19)12(20)4-10/h2-4,6,13-15,23H,5,7-8H2,1H3,(H,21,25,26)/t13-,14-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 461.322 g/mol | logS: -5.18794 | SlogP: 2.5602 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0533688 | Sterimol/B1: 2.20912 | Sterimol/B2: 2.37198 | Sterimol/B3: 6.07144 |
Sterimol/B4: 8.96782 | Sterimol/L: 19.6898 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 704.915 | Positive charged surface: 359.85 | Negative charged surface: 345.065 | Volume: 376.125 |
Hydrophobic surface: 474.788 | Hydrophilic surface: 230.127 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |