 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCC(NC(=O)C(NC(OCc1ccccc1)=O)CO)C(=O)[O-])C |
| InChI: | InChI=1/C16H22N2O6S/c1-25-8-7-12(15(21)22)17-14(20)13(9-19)18-16(23)24-10-11-5-3-2-4-6-11/h2-6,12-13,19H,7-10H2,1H3,(H,17,20)(H,18,23)(H,21,22)/p-1/t12-,13-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=34.5647 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 369.418 g/mol | logS: -3.0278 | SlogP: -0.4721 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.060342 | Sterimol/B1: 2.09637 | Sterimol/B2: 3.87904 | Sterimol/B3: 3.90148 | |||
| Sterimol/B4: 8.72056 | Sterimol/L: 18.4173 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 649.495 | Positive charged surface: 368.318 | Negative charged surface: 281.177 | Volume: 335.25 | |||
| Hydrophobic surface: 420.638 | Hydrophilic surface: 228.857 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
