Type: Neutral
Formula: C16H17N2O7P
SMILES: |
P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)(Oc1ccccc1)=O |
InChI: |
InChI=1/C16H17N2O7P/c1-10-8-18(16(20)17-15(10)19)14-7-12-13(23-14)9-22-26(21,25-12)24-11-5-3-2-4-6-11/h2-6,8,12-14H,7,9H2,1H3,(H,17,19,20)/t12-,13+,14-,26-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 380.293 g/mol | logS: -2.82431 | SlogP: 1.0893 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0456199 | Sterimol/B1: 3.23067 | Sterimol/B2: 3.97943 | Sterimol/B3: 4.23126 |
Sterimol/B4: 4.26232 | Sterimol/L: 18.7886 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.746 | Positive charged surface: 348.899 | Negative charged surface: 234.846 | Volume: 314.125 |
Hydrophobic surface: 412.41 | Hydrophilic surface: 171.336 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |