Type: Neutral
Formula: C14H20N6O4
SMILES: |
O1C(CO)C(CC(=O)N)C(O)C1n1c2ncnc(N(C)C)c2nc1 |
InChI: |
InChI=1/C14H20N6O4/c1-19(2)12-10-13(17-5-16-12)20(6-18-10)14-11(23)7(3-9(15)22)8(4-21)24-14/h5-8,11,14,21,23H,3-4H2,1-2H3,(H2,15,22)/t7-,8+,11+,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 336.352 g/mol | logS: -1.60856 | SlogP: -1.27 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.049712 | Sterimol/B1: 2.21298 | Sterimol/B2: 4.09146 | Sterimol/B3: 4.54936 |
Sterimol/B4: 6.12901 | Sterimol/L: 15.9729 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 545.616 | Positive charged surface: 450.292 | Negative charged surface: 95.3247 | Volume: 296.375 |
Hydrophobic surface: 289.876 | Hydrophilic surface: 255.74 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |