Type: Neutral
Formula: C14H27NO9
SMILES: |
O1C(CO)C(O)C(O)C(NC)C1OC1C(O)(CO)C(OC1OC)C |
InChI: |
InChI=1/C14H27NO9/c1-6-14(20,5-17)11(13(21-3)22-6)24-12-8(15-2)10(19)9(18)7(4-16)23-12/h6-13,15-20H,4-5H2,1-3H3/t6-,7-,8+,9+,10-,11+,12+,13+,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.368 g/mol | logS: 0.69831 | SlogP: -3.4868 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.156369 | Sterimol/B1: 3.76826 | Sterimol/B2: 4.31047 | Sterimol/B3: 4.34613 |
Sterimol/B4: 6.02392 | Sterimol/L: 13.0729 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 544.521 | Positive charged surface: 457.318 | Negative charged surface: 87.203 | Volume: 315.625 |
Hydrophobic surface: 318.7 | Hydrophilic surface: 225.821 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 9 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |