Type: Neutral
Formula: C11H16N2O7S
SMILES: |
S(OC1CC(OC1CO)N1C=C(C)C(=O)NC1=O)(=O)(=O)C |
InChI: |
InChI=1/C11H16N2O7S/c1-6-4-13(11(16)12-10(6)15)9-3-7(8(5-14)19-9)20-21(2,17)18/h4,7-9,14H,3,5H2,1-2H3,(H,12,15,16)/t7-,8-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 320.322 g/mol | logS: -0.86118 | SlogP: -1.1059 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.119124 | Sterimol/B1: 3.62792 | Sterimol/B2: 3.7995 | Sterimol/B3: 4.86165 |
Sterimol/B4: 5.9441 | Sterimol/L: 14.2449 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 502.83 | Positive charged surface: 294.479 | Negative charged surface: 208.351 | Volume: 257.125 |
Hydrophobic surface: 262.506 | Hydrophilic surface: 240.324 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |