 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OC1C2OC3=NC(=N)C=CN3C2OC1CO)(O)(O)=O |
| InChI: | InChI=1/C9H12N3O7P/c10-5-1-2-12-8-7(18-9(12)11-5)6(4(3-13)17-8)19-20(14,15)16/h1-2,4,6-8,10,13H,3H2,(H2,14,15,16)/b10-5+/t4-,6+,7-,8-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-1.96973 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 305.183 g/mol | logS: -0.54174 | SlogP: -2.32733 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.057794 | Sterimol/B1: 2.64749 | Sterimol/B2: 3.56732 | Sterimol/B3: 3.67385 | |||
| Sterimol/B4: 6.36981 | Sterimol/L: 13.9684 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 477.007 | Positive charged surface: 271.424 | Negative charged surface: 205.583 | Volume: 229.5 | |||
| Hydrophobic surface: 161.316 | Hydrophilic surface: 315.691 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
