 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1N1C=2N=C(N)N(N)C(=O)C=2N(C)C1=O |
| InChI: | InChI=1/C11H16N6O6/c1-15-4-7(14-10(12)17(13)8(4)21)16(11(15)22)9-6(20)5(19)3(2-18)23-9/h3,5-6,9,18-20H,2,13H2,1H3,(H2,12,14)/t3-,5+,6+,9+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.531 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 328.285 g/mol | logS: -0.52929 | SlogP: -4.0075 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0766492 | Sterimol/B1: 2.41069 | Sterimol/B2: 3.00677 | Sterimol/B3: 3.88187 | |||
| Sterimol/B4: 8.36333 | Sterimol/L: 12.0354 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 492.362 | Positive charged surface: 384.532 | Negative charged surface: 107.83 | Volume: 261.75 | |||
| Hydrophobic surface: 167.957 | Hydrophilic surface: 324.405 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
