Type: Neutral
Formula: C10H13FN2O7S
SMILES: |
S(OC1CC(OC1CO)N1C=C(F)C(=O)NC1=O)(=O)(=O)C |
InChI: |
InChI=1/C10H13FN2O7S/c1-21(17,18)20-6-2-8(19-7(6)4-14)13-3-5(11)9(15)12-10(13)16/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.285 g/mol | logS: -1.23347 | SlogP: -1.0899 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.186724 | Sterimol/B1: 2.34867 | Sterimol/B2: 3.63314 | Sterimol/B3: 3.82519 |
Sterimol/B4: 8.4265 | Sterimol/L: 12.9081 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 477.477 | Positive charged surface: 256.279 | Negative charged surface: 221.198 | Volume: 242.25 |
Hydrophobic surface: 237.178 | Hydrophilic surface: 240.299 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |