Type: Neutral
Formula: C20H26O3
| SMILES: |
o1c2C3CCC4(C(CCC=C4C)C3(CCc2cc1)C(OC)=O)C |
| InChI: |
InChI=1/C20H26O3/c1-13-5-4-6-16-19(13,2)10-8-15-17-14(9-12-23-17)7-11-20(15,16)18(21)22-3/h5,9,12,15-16H,4,6-8,10-11H2,1-3H3/t15-,16-,19+,20+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 314.425 g/mol | logS: -4.69385 | SlogP: 4.62517 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.368491 | Sterimol/B1: 2.22963 | Sterimol/B2: 4.12566 | Sterimol/B3: 5.50237 |
| Sterimol/B4: 6.23705 | Sterimol/L: 12.2484 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 485.124 | Positive charged surface: 350.321 | Negative charged surface: 134.803 | Volume: 305.5 |
| Hydrophobic surface: 451.221 | Hydrophilic surface: 33.903 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |