 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(COC2OCCCC2)C(OC2OCCCC2)C(OC2OCCCC2)C1N1C=CC(=NC1=O)N |
| InChI: | InChI=1/C24H37N3O8/c25-17-10-11-27(24(28)26-17)23-22(35-20-9-3-6-14-31-20)21(34-19-8-2-5-13-30-19)16(33-23)15-32-18-7-1-4-12-29-18/h10-11,16,18-23H,1-9,12-15H2,(H2,25,26,28)/t16-,18+,19+,20+,21+,22+,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=66.0977 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 495.573 g/mol | logS: -3.44051 | SlogP: 2.3846 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0911523 | Sterimol/B1: 2.82934 | Sterimol/B2: 4.10559 | Sterimol/B3: 5.46902 | |||
| Sterimol/B4: 12.2134 | Sterimol/L: 18.8305 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 810.292 | Positive charged surface: 629.087 | Negative charged surface: 181.205 | Volume: 460.625 | |||
| Hydrophobic surface: 642.371 | Hydrophilic surface: 167.921 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 7 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.