Type: Neutral
Formula: C15H20O4
SMILES: |
O1C2C(C(=C)C1=O)C(O)\C=C(/CCC1OC1(C2)C)\C |
InChI: |
InChI=1/C15H20O4/c1-8-4-5-12-15(3,19-12)7-11-13(10(16)6-8)9(2)14(17)18-11/h6,10-13,16H,2,4-5,7H2,1,3H3/b8-6+/t10-,11-,12+,13+,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 264.321 g/mol | logS: -2.09652 | SlogP: 1.7328 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.243673 | Sterimol/B1: 2.43665 | Sterimol/B2: 3.01702 | Sterimol/B3: 4.09931 |
Sterimol/B4: 8.35301 | Sterimol/L: 11.4453 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 453.821 | Positive charged surface: 276.378 | Negative charged surface: 177.443 | Volume: 260.5 |
Hydrophobic surface: 291.695 | Hydrophilic surface: 162.126 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |