Type: Neutral
Formula: C10H15N3O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(NC)C(=O)NC1=O |
InChI: |
InChI=1/C10H15N3O6/c1-11-4-2-13(10(18)12-8(4)17)9-7(16)6(15)5(3-14)19-9/h2,5-7,9,11,14-16H,3H2,1H3,(H,12,17,18)/t5-,6+,7-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.245 g/mol | logS: 0.29586 | SlogP: -2.962 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.069272 | Sterimol/B1: 3.22798 | Sterimol/B2: 3.44183 | Sterimol/B3: 3.61034 |
Sterimol/B4: 6.26486 | Sterimol/L: 12.5997 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 462.245 | Positive charged surface: 350.597 | Negative charged surface: 111.647 | Volume: 227.75 |
Hydrophobic surface: 206.164 | Hydrophilic surface: 256.081 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |