Type: Neutral
Formula: C11H15N5O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=2N=C(N)N(C)C(=O)C=2NC1=O |
InChI: |
InChI=1/C11H15N5O6/c1-15-8(20)4-7(14-10(15)12)16(11(21)13-4)9-6(19)5(18)3(2-17)22-9/h3,5-6,9,17-19H,2H2,1H3,(H2,12,14)(H,13,21)/t3-,5+,6+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 313.27 g/mol | logS: -0.54936 | SlogP: -3.5936 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0817499 | Sterimol/B1: 3.12626 | Sterimol/B2: 3.73593 | Sterimol/B3: 4.27679 |
Sterimol/B4: 6.52555 | Sterimol/L: 12.9334 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 490.774 | Positive charged surface: 378.704 | Negative charged surface: 112.07 | Volume: 252 |
Hydrophobic surface: 183.649 | Hydrophilic surface: 307.125 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |