Type: Neutral
Formula: C11H15N5O5S
SMILES: |
S=C1N(C)C(=NC=2N(C3OC(CO)C(O)C3O)C(=O)NC1=2)N |
InChI: |
InChI=1/C11H15N5O5S/c1-15-9(22)4-7(14-10(15)12)16(11(20)13-4)8-6(19)5(18)3(2-17)21-8/h3,5-6,8,17-19H,2H2,1H3,(H2,12,14)(H,13,20)/t3-,5+,6-,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.337 g/mol | logS: -1.80264 | SlogP: -2.7928 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.05447 | Sterimol/B1: 2.79336 | Sterimol/B2: 4.07824 | Sterimol/B3: 4.37061 |
Sterimol/B4: 4.93613 | Sterimol/L: 14.3203 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.466 | Positive charged surface: 358.628 | Negative charged surface: 137.838 | Volume: 263.25 |
Hydrophobic surface: 168.252 | Hydrophilic surface: 328.214 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |