Type: Neutral
Formula: C19H16FN3O5
SMILES: |
FC1=CN(C2OC(C(=O)Nc3c4c(ccc3)cccc4)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C19H16FN3O5/c20-12-9-23(19(27)22-17(12)25)15-8-14(24)16(28-15)18(26)21-13-7-3-5-10-4-1-2-6-11(10)13/h1-7,9,14-16,24H,8H2,(H,21,26)(H,22,25,27)/t14-,15-,16+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 385.351 g/mol | logS: -4.74205 | SlogP: 1.7258 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0518052 | Sterimol/B1: 2.96562 | Sterimol/B2: 3.35271 | Sterimol/B3: 4.27702 |
Sterimol/B4: 6.44124 | Sterimol/L: 18.0507 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 594.891 | Positive charged surface: 325.955 | Negative charged surface: 258.578 | Volume: 327 |
Hydrophobic surface: 413.629 | Hydrophilic surface: 181.262 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |