Type: Neutral
Formula: C14H13F3N2O8
SMILES: |
FC(F)(F)C(=O)NC1C(O)C(OC1COC(=O)c1ccc([N+](=O)[O-])cc1)O |
InChI: |
InChI=1/C14H13F3N2O8/c15-14(16,17)13(23)18-9-8(27-12(22)10(9)20)5-26-11(21)6-1-3-7(4-2-6)19(24)25/h1-4,8-10,12,20,22H,5H2,(H,18,23)/t8-,9+,10-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 394.258 g/mol | logS: -3.57953 | SlogP: 0.2967 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0324245 | Sterimol/B1: 3.12759 | Sterimol/B2: 3.40764 | Sterimol/B3: 3.64296 |
Sterimol/B4: 6.99533 | Sterimol/L: 17.0702 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 591.576 | Positive charged surface: 256.897 | Negative charged surface: 334.68 | Volume: 292.5 |
Hydrophobic surface: 225.932 | Hydrophilic surface: 365.644 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |