Type: Neutral
Formula: C10H16ClN5O3
SMILES: |
Clc1nc(nc(NC2CC(CO)C(O)C2O)c1N)N |
InChI: |
InChI=1/C10H16ClN5O3/c11-8-5(12)9(16-10(13)15-8)14-4-1-3(2-17)6(18)7(4)19/h3-4,6-7,17-19H,1-2,12H2,(H3,13,14,15,16)/t3-,4+,6+,7+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 289.723 g/mol | logS: -1.30383 | SlogP: -1.1911 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.116146 | Sterimol/B1: 2.09012 | Sterimol/B2: 4.36513 | Sterimol/B3: 4.585 |
Sterimol/B4: 4.95798 | Sterimol/L: 13.8113 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 492.259 | Positive charged surface: 346.19 | Negative charged surface: 146.069 | Volume: 242.125 |
Hydrophobic surface: 208.364 | Hydrophilic surface: 283.895 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |