Type: Neutral
Formula: C15H18O4
SMILES: |
O1C2C(C(=C)C1=O)C(O)C1(C(C=CC1=O)C(C2)C)C |
InChI: |
InChI=1/C15H18O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h4-5,7,9-10,12-13,17H,2,6H2,1,3H3/t7-,9-,10+,12+,13+,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 262.305 g/mol | logS: -1.97565 | SlogP: 1.2463 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.401849 | Sterimol/B1: 2.57145 | Sterimol/B2: 3.28897 | Sterimol/B3: 4.6203 |
Sterimol/B4: 7.03125 | Sterimol/L: 10.7679 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 420.616 | Positive charged surface: 254.554 | Negative charged surface: 166.061 | Volume: 244.125 |
Hydrophobic surface: 237.473 | Hydrophilic surface: 183.143 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |