Type: Neutral
Formula: C11H17N5O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(N=NN(C)C)C(=O)NC1=O |
InChI: |
InChI=1/C11H17N5O6/c1-15(2)14-13-5-3-16(11(21)12-9(5)20)10-8(19)7(18)6(4-17)22-10/h3,6-8,10,17-19H,4H2,1-2H3,(H,12,20,21)/b14-13-/t6-,7+,8-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 315.286 g/mol | logS: 0.25051 | SlogP: -2.2526 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.116117 | Sterimol/B1: 2.45717 | Sterimol/B2: 4.63493 | Sterimol/B3: 5.05938 |
Sterimol/B4: 5.46609 | Sterimol/L: 11.7952 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 504.095 | Positive charged surface: 348.934 | Negative charged surface: 155.161 | Volume: 260.5 |
Hydrophobic surface: 261.627 | Hydrophilic surface: 242.468 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |