 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC=C)c1ncnc2n(cc(c12)C#N)C1OC(CO)C(O)C1[O-] |
| InChI: | InChI=1/C15H15N4O4S/c1-2-3-24-14-10-8(4-16)5-19(13(10)17-7-18-14)15-12(22)11(21)9(6-20)23-15/h2,5,7,9,11-12,15,20-21H,1,3,6H2/q-1/t9-,11+,12+,15+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=50.7632 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 347.375 g/mol | logS: -3.52464 | SlogP: 0.726284 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0697785 | Sterimol/B1: 3.11382 | Sterimol/B2: 4.7868 | Sterimol/B3: 5.16386 | |||
| Sterimol/B4: 5.46279 | Sterimol/L: 17.4913 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 580.949 | Positive charged surface: 347.508 | Negative charged surface: 226.919 | Volume: 303.375 | |||
| Hydrophobic surface: 252.13 | Hydrophilic surface: 328.819 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
