Type: Neutral
Formula: C11H12BrN3O4S
SMILES: |
Brc1c2c(n(c1)C1OC(CO)C(O)C1O)N=CNC2=S |
InChI: |
InChI=1/C11H12BrN3O4S/c12-4-1-15(9-6(4)10(20)14-3-13-9)11-8(18)7(17)5(2-16)19-11/h1,3,5,7-8,11,16-18H,2H2,(H,13,14,20)/t5-,7+,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.204 g/mol | logS: -2.64448 | SlogP: -0.1039 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.104831 | Sterimol/B1: 3.64094 | Sterimol/B2: 3.78656 | Sterimol/B3: 4.25001 |
Sterimol/B4: 5.62685 | Sterimol/L: 14.0476 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 500.373 | Positive charged surface: 289.598 | Negative charged surface: 210.775 | Volume: 263.25 |
Hydrophobic surface: 229.845 | Hydrophilic surface: 270.528 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |