Type: Neutral
Formula: C14H16BrN3O4S
SMILES: |
Brc1c2c(ncnc2SCC=C)n(c1)C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C14H16BrN3O4S/c1-2-3-23-13-9-7(15)4-18(12(9)16-6-17-13)14-11(21)10(20)8(5-19)22-14/h2,4,6,8,10-11,14,19-21H,1,3,5H2/t8-,10+,11+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 402.269 g/mol | logS: -4.19258 | SlogP: 1.1789 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0522804 | Sterimol/B1: 3.04904 | Sterimol/B2: 4.3104 | Sterimol/B3: 4.50915 |
Sterimol/B4: 5.48364 | Sterimol/L: 17.8655 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 585.706 | Positive charged surface: 363.805 | Negative charged surface: 216.229 | Volume: 311.25 |
Hydrophobic surface: 318.405 | Hydrophilic surface: 267.301 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |