Type: Neutral
Formula: C9H12N2O5S
SMILES: |
S1C(CO)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C9H12N2O5S/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6+,7+,8-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.27 g/mol | logS: -0.72089 | SlogP: -1.7925 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.115797 | Sterimol/B1: 2.53819 | Sterimol/B2: 3.77865 | Sterimol/B3: 3.77952 |
Sterimol/B4: 5.59257 | Sterimol/L: 13.5382 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 413.643 | Positive charged surface: 266.512 | Negative charged surface: 147.131 | Volume: 207.5 |
Hydrophobic surface: 162.408 | Hydrophilic surface: 251.235 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |