Type: Neutral
Formula: C11H14N4O4S
SMILES: |
S=C1N=CNc2n(cnc12)C1OC(CO)C(O)C1OC |
InChI: |
InChI=1/C11H14N4O4S/c1-18-8-7(17)5(2-16)19-11(8)15-4-14-6-9(15)12-3-13-10(6)20/h3-5,7-8,11,16-17H,2H2,1H3,(H,12,13,20)/t5-,7-,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 298.323 g/mol | logS: -2.21319 | SlogP: -0.6265 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.160134 | Sterimol/B1: 2.02772 | Sterimol/B2: 2.50011 | Sterimol/B3: 5.12709 |
Sterimol/B4: 6.73678 | Sterimol/L: 14.0965 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.158 | Positive charged surface: 341.669 | Negative charged surface: 154.489 | Volume: 250.625 |
Hydrophobic surface: 231.875 | Hydrophilic surface: 264.283 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |