 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(C(O)C)C(=O)NC(C(C)C)C(=O)NN |
| InChI: | InChI=1/C17H26N4O5/c1-10(2)13(16(24)21-18)19-15(23)14(11(3)22)20-17(25)26-9-12-7-5-4-6-8-12/h4-8,10-11,13-14,22H,9,18H2,1-3H3,(H,19,23)(H,20,25)(H,21,24)/t11-,13-,14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=101.592 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 366.418 g/mol | logS: -2.89431 | SlogP: 0.0593 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0479531 | Sterimol/B1: 2.02268 | Sterimol/B2: 2.99902 | Sterimol/B3: 4.72035 | |||
| Sterimol/B4: 7.99113 | Sterimol/L: 19.6151 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 655.745 | Positive charged surface: 418.616 | Negative charged surface: 237.128 | Volume: 347.375 | |||
| Hydrophobic surface: 383.274 | Hydrophilic surface: 272.471 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.