 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C2OC(OC2C1N1C=CC(=O)NC1=O)(C)C)COC(c1ccccc1)(c1ccccc1)c1 ccccc1 |
| InChI: | InChI=1/C31H30N2O6/c1-30(2)38-26-24(37-28(27(26)39-30)33-19-18-25(34)32-29(33)35)20-36-31(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-19,24,26-28H,20H2,1-2H3,(H,32,34,35)/t24-,26+,27-,28+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=167.984 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 526.589 g/mol | logS: -7.07011 | SlogP: 4.6171 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.219633 | Sterimol/B1: 3.43828 | Sterimol/B2: 4.80375 | Sterimol/B3: 7.22837 | |||
| Sterimol/B4: 8.5129 | Sterimol/L: 17.3346 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 780.281 | Positive charged surface: 453.72 | Negative charged surface: 326.561 | Volume: 494.625 | |||
| Hydrophobic surface: 608.736 | Hydrophilic surface: 171.545 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.