Type: Neutral
Formula: C10H13N3O7
SMILES: |
O1C(C(=O)N)C(O)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H13N3O7/c11-8(18)7-5(16)4(15)6(17)9(20-7)13-2-1-3(14)12-10(13)19/h1-2,4-7,9,15-17H,(H2,11,18)(H,12,14,19)/t4-,5+,6+,7-,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 287.228 g/mol | logS: -0.15021 | SlogP: -3.6552 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.257484 | Sterimol/B1: 2.26205 | Sterimol/B2: 4.34354 | Sterimol/B3: 4.66515 |
Sterimol/B4: 5.05457 | Sterimol/L: 11.1313 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 434.476 | Positive charged surface: 263.323 | Negative charged surface: 171.153 | Volume: 221.25 |
Hydrophobic surface: 100.613 | Hydrophilic surface: 333.863 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |