Type: Neutral
Formula: C10H13N3O7
SMILES: |
O1C(C(=O)N)C(O)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C10H13N3O7/c11-8(18)7-5(16)4(15)6(17)9(20-7)13-2-1-3(14)12-10(13)19/h1-2,4-7,9,15-17H,(H2,11,18)(H,12,14,19)/t4-,5+,6-,7-,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 287.228 g/mol | logS: -0.15021 | SlogP: -3.6552 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.104154 | Sterimol/B1: 2.84642 | Sterimol/B2: 2.91184 | Sterimol/B3: 3.7001 |
Sterimol/B4: 6.37595 | Sterimol/L: 13.1954 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 442.938 | Positive charged surface: 280.679 | Negative charged surface: 162.259 | Volume: 224.25 |
Hydrophobic surface: 123.62 | Hydrophilic surface: 319.318 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |