Type: Neutral
Formula: C11H14N2O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(C=CC1=O)C(=O)N |
InChI: |
InChI=1/C11H14N2O6/c12-10(18)5-1-2-7(15)13(3-5)11-9(17)8(16)6(4-14)19-11/h1-3,6,8-9,11,14,16-17H,4H2,(H2,12,18)/t6-,8+,9+,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 270.241 g/mol | logS: -0.43709 | SlogP: -2.807 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0768984 | Sterimol/B1: 3.21154 | Sterimol/B2: 3.53868 | Sterimol/B3: 4.08809 |
Sterimol/B4: 5.99851 | Sterimol/L: 11.795 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 447.364 | Positive charged surface: 288.05 | Negative charged surface: 159.314 | Volume: 223.5 |
Hydrophobic surface: 170.321 | Hydrophilic surface: 277.043 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |