Type: Neutral
Formula: C11H14N4O5S
SMILES: |
S=C1N=CNc2n(cnc12)C1OC(C(O)CO)C(O)C1O |
InChI: |
InChI=1/C11H14N4O5S/c16-1-4(17)8-6(18)7(19)11(20-8)15-3-14-5-9(15)12-2-13-10(5)21/h2-4,6-8,11,16-19H,1H2,(H,12,13,21)/t4-,6+,7-,8+,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.322 g/mol | logS: -1.66547 | SlogP: -1.9197 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.082571 | Sterimol/B1: 2.67114 | Sterimol/B2: 4.11191 | Sterimol/B3: 4.5078 |
Sterimol/B4: 5.78864 | Sterimol/L: 14.2437 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 487.759 | Positive charged surface: 317.296 | Negative charged surface: 170.463 | Volume: 253.75 |
Hydrophobic surface: 164.848 | Hydrophilic surface: 322.911 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |