Type: Neutral
Formula: C8H16O10S3
| SMILES: |
S(OC1C(O)C(O)C(OC1OC)CSS(O)(=O)=O)(=O)(=O)C |
| InChI: |
InChI=1/C8H16O10S3/c1-16-8-7(18-20(2,11)12)6(10)5(9)4(17-8)3-19-21(13,14)15/h4-10H,3H2,1-2H3,(H,13,14,15)/t4-,5+,6+,7-,8+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 368.404 g/mol | logS: -0.99039 | SlogP: -2.6054 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.153375 | Sterimol/B1: 2.12357 | Sterimol/B2: 2.96788 | Sterimol/B3: 4.32611 |
| Sterimol/B4: 7.1507 | Sterimol/L: 13.9624 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 495.605 | Positive charged surface: 256.843 | Negative charged surface: 238.762 | Volume: 263 |
| Hydrophobic surface: 186.422 | Hydrophilic surface: 309.183 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 5 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|