Type: Neutral
Formula: C11H15N5O5S
SMILES: |
S(C)c1nc2c(n1C1OC(CO)C(O)C1O)N=C(NC2=O)N |
InChI: |
InChI=1/C11H15N5O5S/c1-22-11-13-4-7(14-10(12)15-8(4)20)16(11)9-6(19)5(18)3(2-17)21-9/h3,5-6,9,17-19H,2H2,1H3,(H3,12,14,15,20)/t3-,5+,6-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.337 g/mol | logS: -2.2888 | SlogP: -1.9984 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0879482 | Sterimol/B1: 3.22234 | Sterimol/B2: 3.47332 | Sterimol/B3: 4.39259 |
Sterimol/B4: 6.48946 | Sterimol/L: 13.4122 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 494.249 | Positive charged surface: 339.822 | Negative charged surface: 154.428 | Volume: 263.5 |
Hydrophobic surface: 184.579 | Hydrophilic surface: 309.67 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |