Type: Neutral
Formula: C6H13O9P
SMILES: |
P(OCC(O)C(O)C(O)CC(O)=O)(O)(O)=O |
InChI: |
InChI=1/C6H13O9P/c7-3(1-5(9)10)6(11)4(8)2-15-16(12,13)14/h3-4,6-8,11H,1-2H2,(H,9,10)(H2,12,13,14)/t3-,4+,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.135 g/mol | logS: 1.55428 | SlogP: -3.4171 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0548058 | Sterimol/B1: 2.78536 | Sterimol/B2: 3.05282 | Sterimol/B3: 3.60482 |
Sterimol/B4: 3.88338 | Sterimol/L: 15.4213 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 440.293 | Positive charged surface: 259.619 | Negative charged surface: 180.674 | Volume: 196 |
Hydrophobic surface: 92.6042 | Hydrophilic surface: 347.6888 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|