Type: Neutral
Formula: C13H17NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)c2ccccc2)C1O |
InChI: |
InChI=1/C13H17NO6/c15-6-8-10(16)11(17)9(13(19)20-8)14-12(18)7-4-2-1-3-5-7/h1-5,8-11,13,15-17,19H,6H2,(H,14,18)/t8-,9+,10+,11+,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.28 g/mol | logS: -0.89306 | SlogP: -1.7837 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.145219 | Sterimol/B1: 3.26509 | Sterimol/B2: 3.59918 | Sterimol/B3: 4.89533 |
Sterimol/B4: 5.42966 | Sterimol/L: 13.5753 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 491.297 | Positive charged surface: 325.282 | Negative charged surface: 166.015 | Volume: 249.625 |
Hydrophobic surface: 285.279 | Hydrophilic surface: 206.018 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |