Type: Neutral
Formula: C10H12N4O4S
SMILES: |
S=C1N=CNc2c1[nH]nc2C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C10H12N4O4S/c15-1-3-7(16)8(17)9(18-3)5-4-6(14-13-5)10(19)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,19)/t3-,7+,8-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 284.296 g/mol | logS: -1.74031 | SlogP: -1.2115 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.126197 | Sterimol/B1: 3.00155 | Sterimol/B2: 3.19605 | Sterimol/B3: 4.39265 |
Sterimol/B4: 5.70227 | Sterimol/L: 13.8989 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 468.055 | Positive charged surface: 296.466 | Negative charged surface: 171.589 | Volume: 230.5 |
Hydrophobic surface: 124.476 | Hydrophilic surface: 343.579 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |