Type: Neutral
Formula: C11H14N4O5S
| SMILES: |
S(C)c1nc2c(n1C1OC(CO)C(O)C1O)N=CNC2=O |
| InChI: |
InChI=1/C11H14N4O5S/c1-21-11-14-5-8(12-3-13-9(5)19)15(11)10-7(18)6(17)4(2-16)20-10/h3-4,6-7,10,16-18H,2H2,1H3,(H,12,13,19)/t4-,6+,7-,10+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 314.322 g/mol | logS: -2.23787 | SlogP: -1.2848 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0917695 | Sterimol/B1: 3.19423 | Sterimol/B2: 3.22656 | Sterimol/B3: 3.46558 |
| Sterimol/B4: 7.45896 | Sterimol/L: 12.8735 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 481.149 | Positive charged surface: 335.979 | Negative charged surface: 145.17 | Volume: 254.5 |
| Hydrophobic surface: 204.016 | Hydrophilic surface: 277.133 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |