Type: Neutral
Formula: C17H19N3O8
SMILES: |
O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1n1c2N=CNC(=O)c2cc1 |
InChI: |
InChI=1/C17H19N3O8/c1-8(21)25-6-12-13(26-9(2)22)14(27-10(3)23)17(28-12)20-5-4-11-15(20)18-7-19-16(11)24/h4-5,7,12-14,17H,6H2,1-3H3,(H,18,19,24)/t12-,13-,14-,17+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 393.352 g/mol | logS: -2.15502 | SlogP: 0.3107 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.234847 | Sterimol/B1: 2.38954 | Sterimol/B2: 4.67184 | Sterimol/B3: 5.37071 |
Sterimol/B4: 7.38177 | Sterimol/L: 15.9266 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 611.377 | Positive charged surface: 373.529 | Negative charged surface: 237.848 | Volume: 337.5 |
Hydrophobic surface: 377.221 | Hydrophilic surface: 234.156 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |