Type: Neutral
Formula: C12H17N5O5
SMILES: |
O1C(CO)C(O)C(O)C1n1c2N=CNC(=O)c2nc1N(C)C |
InChI: |
InChI=1/C12H17N5O5/c1-16(2)12-15-6-9(13-4-14-10(6)21)17(12)11-8(20)7(19)5(3-18)22-11/h4-5,7-8,11,18-20H,3H2,1-2H3,(H,13,14,21)/t5-,7+,8-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 311.298 g/mol | logS: -1.14388 | SlogP: -1.9407 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.199301 | Sterimol/B1: 2.52323 | Sterimol/B2: 3.23962 | Sterimol/B3: 4.88091 |
Sterimol/B4: 8.29305 | Sterimol/L: 12.0161 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 517.966 | Positive charged surface: 413.639 | Negative charged surface: 104.327 | Volume: 266.125 |
Hydrophobic surface: 261.392 | Hydrophilic surface: 256.574 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |