 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCC(NC(=O)C(NC(OCc1ccccc1)=O)C(C)C)C(=O)[O-])C |
| InChI: | InChI=1/C18H26N2O5S/c1-12(2)15(16(21)19-14(17(22)23)9-10-26-3)20-18(24)25-11-13-7-5-4-6-8-13/h4-8,12,14-15H,9-11H2,1-3H3,(H,19,21)(H,20,24)(H,22,23)/p-1/t14-,15+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=37.9038 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 381.473 g/mol | logS: -3.96109 | SlogP: 1.1916 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.142399 | Sterimol/B1: 2.44777 | Sterimol/B2: 2.47064 | Sterimol/B3: 7.32504 | |||
| Sterimol/B4: 8.67754 | Sterimol/L: 16.9426 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 674.201 | Positive charged surface: 381.558 | Negative charged surface: 292.643 | Volume: 366 | |||
| Hydrophobic surface: 442.591 | Hydrophilic surface: 231.61 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
