Type: Neutral
Formula: C16H18N4O8
SMILES: |
O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1n1ncc2c1N=CNC2=O |
InChI: |
InChI=1/C16H18N4O8/c1-7(21)25-5-11-12(26-8(2)22)13(27-9(3)23)16(28-11)20-14-10(4-19-20)15(24)18-6-17-14/h4,6,11-13,16H,5H2,1-3H3,(H,17,18,24)/t11-,12+,13+,16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 394.34 g/mol | logS: -2.14784 | SlogP: -0.2943 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.1228 | Sterimol/B1: 2.10132 | Sterimol/B2: 3.78905 | Sterimol/B3: 4.5464 |
Sterimol/B4: 9.15495 | Sterimol/L: 15.5805 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 624.74 | Positive charged surface: 404.421 | Negative charged surface: 220.319 | Volume: 330.875 |
Hydrophobic surface: 381.406 | Hydrophilic surface: 243.334 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |