Type: Neutral
Formula: C10H12N4O5
SMILES: |
O1C(C(O)C(O)C1CO)c1n[nH]c2c1N=CNC2=O |
InChI: |
InChI=1/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18)/t3-,7+,8-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.229 g/mol | logS: -0.48703 | SlogP: -1.9376 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125773 | Sterimol/B1: 2.34524 | Sterimol/B2: 2.55241 | Sterimol/B3: 4.62704 |
Sterimol/B4: 6.00255 | Sterimol/L: 12.9682 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 446.833 | Positive charged surface: 321.78 | Negative charged surface: 125.053 | Volume: 217.125 |
Hydrophobic surface: 123.052 | Hydrophilic surface: 323.781 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |