Type: Neutral
Formula: C12H13N5O4
SMILES: |
O1C(CO)C(O)C(O)C1n1cc(c2c1ncnc2N)C#N |
InChI: |
InChI=1/C12H13N5O4/c13-1-5-2-17(11-7(5)10(14)15-4-16-11)12-9(20)8(19)6(3-18)21-12/h2,4,6,8-9,12,18-20H,3H2,(H2,14,15,16)/t6-,8+,9+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 291.267 g/mol | logS: -1.65637 | SlogP: -1.40782 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0954965 | Sterimol/B1: 3.49481 | Sterimol/B2: 4.04934 | Sterimol/B3: 4.44911 |
Sterimol/B4: 6.07279 | Sterimol/L: 13.8409 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 485.225 | Positive charged surface: 345.817 | Negative charged surface: 134.395 | Volume: 248.125 |
Hydrophobic surface: 153.37 | Hydrophilic surface: 331.855 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |