 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CCc1ccccc1)c1nc(nc2n(cnc12)C1OC(CO)C(O)C1[O-])N |
| InChI: | InChI=1/C18H20N5O4S/c19-18-21-15-12(16(22-18)28-7-6-10-4-2-1-3-5-10)20-9-23(15)17-14(26)13(25)11(8-24)27-17/h1-5,9,11,13-14,17,24-25H,6-8H2,(H2,19,21,22)/q-1/t11-,13+,14+,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=47.2836 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 402.455 g/mol | logS: -4.48671 | SlogP: 0.88847 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0434833 | Sterimol/B1: 3.55387 | Sterimol/B2: 4.06536 | Sterimol/B3: 4.13569 | |||
| Sterimol/B4: 4.68747 | Sterimol/L: 20.4993 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 669.995 | Positive charged surface: 428.061 | Negative charged surface: 241.934 | Volume: 355.5 | |||
| Hydrophobic surface: 397.333 | Hydrophilic surface: 272.662 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
