Type: Neutral
Formula: C16H20N4O4
SMILES: |
O1C(CNc2ncccc2)C(O)C(O)C(O)C1Nc1ncccc1 |
InChI: |
InChI=1/C16H20N4O4/c21-13-10(9-19-11-5-1-3-7-17-11)24-16(15(23)14(13)22)20-12-6-2-4-8-18-12/h1-8,10,13-16,21-23H,9H2,(H,17,19)(H,18,20)/t10-,13+,14-,15-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 332.36 g/mol | logS: -0.44297 | SlogP: -0.1918 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0884945 | Sterimol/B1: 3.36133 | Sterimol/B2: 3.74456 | Sterimol/B3: 5.79365 |
Sterimol/B4: 6.31003 | Sterimol/L: 14.1656 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 567.098 | Positive charged surface: 397.529 | Negative charged surface: 169.569 | Volume: 305.75 |
Hydrophobic surface: 384.26 | Hydrophilic surface: 182.838 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |