Type: Neutral
Formula: C10H19NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)CCC)C1O |
InChI: |
InChI=1/C10H19NO6/c1-2-3-6(13)11-7-9(15)8(14)5(4-12)17-10(7)16/h5,7-10,12,14-16H,2-4H2,1H3,(H,11,13)/t5-,7-,8+,9+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 249.263 g/mol | logS: 0.15049 | SlogP: -2.2974 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0674917 | Sterimol/B1: 3.13864 | Sterimol/B2: 3.64509 | Sterimol/B3: 4.00647 |
Sterimol/B4: 4.04252 | Sterimol/L: 15.2893 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 465.41 | Positive charged surface: 358.94 | Negative charged surface: 106.47 | Volume: 223 |
Hydrophobic surface: 234.056 | Hydrophilic surface: 231.354 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |