Type: Neutral
Formula: C25H32O4
SMILES: |
O(C(=O)c1cc(ccc1)C(OCCCCCCCC(C)C)=O)Cc1ccccc1 |
InChI: |
InChI=1/C25H32O4/c1-20(2)12-7-4-3-5-10-17-28-24(26)22-15-11-16-23(18-22)25(27)29-19-21-13-8-6-9-14-21/h6,8-9,11,13-16,18,20H,3-5,7,10,12,17,19H2,1-2H3 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 396.527 g/mol | logS: -8.05176 | SlogP: 6.4634 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0129395 | Sterimol/B1: 2.79289 | Sterimol/B2: 2.83975 | Sterimol/B3: 4.55874 |
Sterimol/B4: 5.53843 | Sterimol/L: 27.8397 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 800.363 | Positive charged surface: 533.885 | Negative charged surface: 266.479 | Volume: 419.25 |
Hydrophobic surface: 679.908 | Hydrophilic surface: 120.455 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |